C8H11F3N4O — CID 136976588
5-amino-4-(4,4,4-trifluorobutylamino)-1H-pyrimidin-6-one (PubChem CID 136976588) has the molecular formula C8H11F3N4O and a molecular weight of 236.20 g/mol. Its IUPAC name is 5-amino-4-(4,4,4-trifluorobutylamino)-1H-pyrimidin-6-one.
| Compound Name | 5-amino-4-(4,4,4-trifluorobutylamino)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136976588 |
| Molecular Formula | C8H11F3N4O |
| Molecular Weight | 236.20 g/mol |
| Exact Mass | 236.09 |
| IUPAC Name | 5-amino-4-(4,4,4-trifluorobutylamino)-1H-pyrimidin-6-one |
| SMILES | Nc1c(NCCCC(F)(F)F)nc[nH]c1=O |
| InChI | InChI=1S/C8H11F3N4O/c9-8(10,11)2-1-3-13-6-5(12)7(16)15-4-14-6/h4H,1-3,12H2,(H2,13,14,15,16) |
| InChIKey | CWUSBCBWIOPECP-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.20 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|