C8H10F3N3O — CID 136957051
4-(4,4,4-trifluorobutylamino)-1H-pyrimidin-6-one (PubChem CID 136957051) has the molecular formula C8H10F3N3O and a molecular weight of 221.18 g/mol. Its IUPAC name is 4-(4,4,4-trifluorobutylamino)-1H-pyrimidin-6-one.
| Compound Name | 4-(4,4,4-trifluorobutylamino)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136957051 |
| Molecular Formula | C8H10F3N3O |
| Molecular Weight | 221.18 g/mol |
| Exact Mass | 221.08 |
| IUPAC Name | 4-(4,4,4-trifluorobutylamino)-1H-pyrimidin-6-one |
| SMILES | O=c1cc(NCCCC(F)(F)F)nc[nH]1 |
| InChI | InChI=1S/C8H10F3N3O/c9-8(10,11)2-1-3-12-6-4-7(15)14-5-13-6/h4-5H,1-3H2,(H2,12,13,14,15) |
| InChIKey | HUAZDCSLJSTHID-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.18 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|