C8H8F3N3O — CID 136736694
4-[[1-(trifluoromethyl)cyclopropyl]amino]-1H-pyrimidin-6-one (PubChem CID 136736694) has the molecular formula C8H8F3N3O and a molecular weight of 219.17 g/mol. Its IUPAC name is 4-[[1-(trifluoromethyl)cyclopropyl]amino]-1H-pyrimidin-6-one.
| Compound Name | 4-[[1-(trifluoromethyl)cyclopropyl]amino]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136736694 |
| Molecular Formula | C8H8F3N3O |
| Molecular Weight | 219.17 g/mol |
| Exact Mass | 219.06 |
| IUPAC Name | 4-[[1-(trifluoromethyl)cyclopropyl]amino]-1H-pyrimidin-6-one |
| SMILES | O=c1cc(NC2(C(F)(F)F)CC2)nc[nH]1 |
| InChI | InChI=1S/C8H8F3N3O/c9-8(10,11)7(1-2-7)14-5-3-6(15)13-4-12-5/h3-4H,1-2H2,(H2,12,13,14,15) |
| InChIKey | OBKFSDJTUQUIJA-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.17 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |