C6H7F2N3O — CID 136957014
4-(2,2-difluoroethylamino)-1H-pyrimidin-6-one (PubChem CID 136957014) has the molecular formula C6H7F2N3O and a molecular weight of 175.14 g/mol. Its IUPAC name is 4-(2,2-difluoroethylamino)-1H-pyrimidin-6-one.
| Compound Name | 4-(2,2-difluoroethylamino)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136957014 |
| Molecular Formula | C6H7F2N3O |
| Molecular Weight | 175.14 g/mol |
| Exact Mass | 175.06 |
| IUPAC Name | 4-(2,2-difluoroethylamino)-1H-pyrimidin-6-one |
| SMILES | O=c1cc(NCC(F)F)nc[nH]1 |
| InChI | InChI=1S/C6H7F2N3O/c7-4(8)2-9-5-1-6(12)11-3-10-5/h1,3-4H,2H2,(H2,9,10,11,12) |
| InChIKey | YRWZGBRTZIBJDU-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.14 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |