C8H7ClF3N3O — CID 136736700
5-chloro-4-[[1-(trifluoromethyl)cyclopropyl]amino]-1H-pyrimidin-6-one (PubChem CID 136736700) has the molecular formula C8H7ClF3N3O and a molecular weight of 253.61 g/mol. Its IUPAC name is 5-chloro-4-[[1-(trifluoromethyl)cyclopropyl]amino]-1H-pyrimidin-6-one.
| Compound Name | 5-chloro-4-[[1-(trifluoromethyl)cyclopropyl]amino]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136736700 |
| Molecular Formula | C8H7ClF3N3O |
| Molecular Weight | 253.61 g/mol |
| Exact Mass | 253.02 |
| IUPAC Name | 5-chloro-4-[[1-(trifluoromethyl)cyclopropyl]amino]-1H-pyrimidin-6-one |
| SMILES | O=c1[nH]cnc(NC2(C(F)(F)F)CC2)c1Cl |
| InChI | InChI=1S/C8H7ClF3N3O/c9-4-5(13-3-14-6(4)16)15-7(1-2-7)8(10,11)12/h3H,1-2H2,(H2,13,14,15,16) |
| InChIKey | QRCIWCHBDDVMBN-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.61 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |