C8H12ClN3O — CID 137009466
4-(tert-butylamino)-5-chloro-1H-pyrimidin-6-one (PubChem CID 137009466) has the molecular formula C8H12ClN3O and a molecular weight of 201.66 g/mol. Its IUPAC name is 4-(tert-butylamino)-5-chloro-1H-pyrimidin-6-one.
| Compound Name | 4-(tert-butylamino)-5-chloro-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 137009466 |
| Molecular Formula | C8H12ClN3O |
| Molecular Weight | 201.66 g/mol |
| Exact Mass | 201.07 |
| IUPAC Name | 4-(tert-butylamino)-5-chloro-1H-pyrimidin-6-one |
| SMILES | CC(C)(C)Nc1nc[nH]c(=O)c1Cl |
| InChI | InChI=1S/C8H12ClN3O/c1-8(2,3)12-6-5(9)7(13)11-4-10-6/h4H,1-3H3,(H2,10,11,12,13) |
| InChIKey | TYAQFFBFAKFWMG-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.66 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |