C6H6F3N3O — CID 136955984
4-(2,2,2-trifluoroethylamino)-1H-pyrimidin-6-one (PubChem CID 136955984) has the molecular formula C6H6F3N3O and a molecular weight of 193.13 g/mol. Its IUPAC name is 4-(2,2,2-trifluoroethylamino)-1H-pyrimidin-6-one.
| Compound Name | 4-(2,2,2-trifluoroethylamino)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136955984 |
| Molecular Formula | C6H6F3N3O |
| Molecular Weight | 193.13 g/mol |
| Exact Mass | 193.05 |
| IUPAC Name | 4-(2,2,2-trifluoroethylamino)-1H-pyrimidin-6-one |
| SMILES | O=c1cc(NCC(F)(F)F)nc[nH]1 |
| InChI | InChI=1S/C6H6F3N3O/c7-6(8,9)2-10-4-1-5(13)12-3-11-4/h1,3H,2H2,(H2,10,11,12,13) |
| InChIKey | RTXHTHADFFIABA-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.13 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |