C8H12F2N4O2 — CID 136896830
5-amino-4-[2-(2,2-difluoroethoxy)ethylamino]-1H-pyrimidin-6-one (PubChem CID 136896830) has the molecular formula C8H12F2N4O2 and a molecular weight of 234.21 g/mol. Its IUPAC name is 5-amino-4-[2-(2,2-difluoroethoxy)ethylamino]-1H-pyrimidin-6-one.
| Compound Name | 5-amino-4-[2-(2,2-difluoroethoxy)ethylamino]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136896830 |
| Molecular Formula | C8H12F2N4O2 |
| Molecular Weight | 234.21 g/mol |
| Exact Mass | 234.09 |
| IUPAC Name | 5-amino-4-[2-(2,2-difluoroethoxy)ethylamino]-1H-pyrimidin-6-one |
| SMILES | Nc1c(NCCOCC(F)F)nc[nH]c1=O |
| InChI | InChI=1S/C8H12F2N4O2/c9-5(10)3-16-2-1-12-7-6(11)8(15)14-4-13-7/h4-5H,1-3,11H2,(H2,12,13,14,15) |
| InChIKey | MUHYFRUVVHHLAX-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 93.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.21 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|