C9H11F3IN3O — CID 136957055
5-iodo-4-(5,5,5-trifluoropentylamino)-1H-pyrimidin-6-one (PubChem CID 136957055) has the molecular formula C9H11F3IN3O and a molecular weight of 361.11 g/mol. Its IUPAC name is 5-iodo-4-(5,5,5-trifluoropentylamino)-1H-pyrimidin-6-one.
| Compound Name | 5-iodo-4-(5,5,5-trifluoropentylamino)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136957055 |
| Molecular Formula | C9H11F3IN3O |
| Molecular Weight | 361.11 g/mol |
| Exact Mass | 360.99 |
| IUPAC Name | 5-iodo-4-(5,5,5-trifluoropentylamino)-1H-pyrimidin-6-one |
| SMILES | O=c1[nH]cnc(NCCCCC(F)(F)F)c1I |
| InChI | InChI=1S/C9H11F3IN3O/c10-9(11,12)3-1-2-4-14-7-6(13)8(17)16-5-15-7/h5H,1-4H2,(H2,14,15,16,17) |
| InChIKey | ZKAYLPKOKCOMGL-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.11 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|