C7H7F3IN3O — CID 136956607
5-iodo-4-(3,3,3-trifluoropropylamino)-1H-pyrimidin-6-one (PubChem CID 136956607) has the molecular formula C7H7F3IN3O and a molecular weight of 333.05 g/mol. Its IUPAC name is 5-iodo-4-(3,3,3-trifluoropropylamino)-1H-pyrimidin-6-one.
| Compound Name | 5-iodo-4-(3,3,3-trifluoropropylamino)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136956607 |
| Molecular Formula | C7H7F3IN3O |
| Molecular Weight | 333.05 g/mol |
| Exact Mass | 332.96 |
| IUPAC Name | 5-iodo-4-(3,3,3-trifluoropropylamino)-1H-pyrimidin-6-one |
| SMILES | O=c1[nH]cnc(NCCC(F)(F)F)c1I |
| InChI | InChI=1S/C7H7F3IN3O/c8-7(9,10)1-2-12-5-4(11)6(15)14-3-13-5/h3H,1-2H2,(H2,12,13,14,15) |
| InChIKey | BDHVKTDPVDLRRN-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.05 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|