C8H9F3IN3O — CID 136786690
5-iodo-4-(4,4,4-trifluorobutan-2-ylamino)-1H-pyrimidin-6-one (PubChem CID 136786690) has the molecular formula C8H9F3IN3O and a molecular weight of 347.08 g/mol. Its IUPAC name is 5-iodo-4-(4,4,4-trifluorobutan-2-ylamino)-1H-pyrimidin-6-one.
| Compound Name | 5-iodo-4-(4,4,4-trifluorobutan-2-ylamino)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136786690 |
| Molecular Formula | C8H9F3IN3O |
| Molecular Weight | 347.08 g/mol |
| Exact Mass | 346.97 |
| IUPAC Name | 5-iodo-4-(4,4,4-trifluorobutan-2-ylamino)-1H-pyrimidin-6-one |
| SMILES | CC(CC(F)(F)F)Nc1nc[nH]c(=O)c1I |
| InChI | InChI=1S/C8H9F3IN3O/c1-4(2-8(9,10)11)15-6-5(12)7(16)14-3-13-6/h3-4H,2H2,1H3,(H2,13,14,15,16) |
| InChIKey | KLRVOULJZBXJBF-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.08 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|