C6H5F3IN3O — CID 136955981
5-iodo-4-(2,2,2-trifluoroethylamino)-1H-pyrimidin-6-one (PubChem CID 136955981) has the molecular formula C6H5F3IN3O and a molecular weight of 319.02 g/mol. Its IUPAC name is 5-iodo-4-(2,2,2-trifluoroethylamino)-1H-pyrimidin-6-one.
| Compound Name | 5-iodo-4-(2,2,2-trifluoroethylamino)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136955981 |
| Molecular Formula | C6H5F3IN3O |
| Molecular Weight | 319.02 g/mol |
| Exact Mass | 318.94 |
| IUPAC Name | 5-iodo-4-(2,2,2-trifluoroethylamino)-1H-pyrimidin-6-one |
| SMILES | O=c1[nH]cnc(NCC(F)(F)F)c1I |
| InChI | InChI=1S/C6H5F3IN3O/c7-6(8,9)1-11-4-3(10)5(14)13-2-12-4/h2H,1H2,(H2,11,12,13,14) |
| InChIKey | NWVJNOAHUFILNE-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.02 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|