C7H6F4IN3O — CID 136819407
5-iodo-4-(2,2,3,3-tetrafluoropropylamino)-1H-pyrimidin-6-one (PubChem CID 136819407) has the molecular formula C7H6F4IN3O and a molecular weight of 351.04 g/mol. Its IUPAC name is 5-iodo-4-(2,2,3,3-tetrafluoropropylamino)-1H-pyrimidin-6-one.
| Compound Name | 5-iodo-4-(2,2,3,3-tetrafluoropropylamino)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136819407 |
| Molecular Formula | C7H6F4IN3O |
| Molecular Weight | 351.04 g/mol |
| Exact Mass | 350.95 |
| IUPAC Name | 5-iodo-4-(2,2,3,3-tetrafluoropropylamino)-1H-pyrimidin-6-one |
| SMILES | O=c1[nH]cnc(NCC(F)(F)C(F)F)c1I |
| InChI | InChI=1S/C7H6F4IN3O/c8-6(9)7(10,11)1-13-4-3(12)5(16)15-2-14-4/h2,6H,1H2,(H2,13,14,15,16) |
| InChIKey | QOYYWFKPTMNNSO-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.04 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|