C9H16N6O3 — CID 135818385
2-amino-4-(5-aminopentylamino)-5-nitro-1H-pyrimidin-6-one (PubChem CID 135818385) has the molecular formula C9H16N6O3 and a molecular weight of 256.27 g/mol. Its IUPAC name is 2-amino-4-(5-aminopentylamino)-5-nitro-1H-pyrimidin-6-one.
| Compound Name | 2-amino-4-(5-aminopentylamino)-5-nitro-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 135818385 |
| Molecular Formula | C9H16N6O3 |
| Molecular Weight | 256.27 g/mol |
| Exact Mass | 256.13 |
| IUPAC Name | 2-amino-4-(5-aminopentylamino)-5-nitro-1H-pyrimidin-6-one |
| SMILES | NCCCCCNc1nc(N)[nH]c(=O)c1[N+](=O)[O-] |
| InChI | InChI=1S/C9H16N6O3/c10-4-2-1-3-5-12-7-6(15(17)18)8(16)14-9(11)13-7/h1-5,10H2,(H4,11,12,13,14,16) |
| InChIKey | OUJKCVJCMLEMSO-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 152.96 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.27 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|