C18H20ClFN2OS — CID 136504308
4-[1-(2-chloro-6-fluorophenyl)ethyl]-2-cyclopentylsulfanyl-5-methyl-1H-pyrimidin-6-one (PubChem CID 136504308) has the molecular formula C18H20ClFN2OS and a molecular weight of 366.89 g/mol. Its IUPAC name is 4-[1-(2-chloro-6-fluorophenyl)ethyl]-2-cyclopentylsulfanyl-5-methyl-1H-pyrimidin-6-one.
| Compound Name | 4-[1-(2-chloro-6-fluorophenyl)ethyl]-2-cyclopentylsulfanyl-5-methyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136504308 |
| Molecular Formula | C18H20ClFN2OS |
| Molecular Weight | 366.89 g/mol |
| Exact Mass | 366.10 |
| IUPAC Name | 4-[1-(2-chloro-6-fluorophenyl)ethyl]-2-cyclopentylsulfanyl-5-methyl-1H-pyrimidin-6-one |
| SMILES | Cc1c(C(C)c2c(F)cccc2Cl)nc(SC2CCCC2)[nH]c1=O |
| InChI | InChI=1S/C18H20ClFN2OS/c1-10(15-13(19)8-5-9-14(15)20)16-11(2)17(23)22-18(21-16)24-12-6-3-4-7-12/h5,8-10,12H,3-4,6-7H2,1-2H3,(H,21,22,23) |
| InChIKey | QRVYKVAVPKUTGP-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.89 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |