C7H11N3O — CID 136504671
4-[ethyl(methyl)amino]-1H-pyrimidin-6-one (PubChem CID 136504671) has the molecular formula C7H11N3O and a molecular weight of 153.19 g/mol. Its IUPAC name is 4-[ethyl(methyl)amino]-1H-pyrimidin-6-one.
| Compound Name | 4-[ethyl(methyl)amino]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136504671 |
| Molecular Formula | C7H11N3O |
| Molecular Weight | 153.19 g/mol |
| Exact Mass | 153.09 |
| IUPAC Name | 4-[ethyl(methyl)amino]-1H-pyrimidin-6-one |
| SMILES | CCN(C)c1cc(=O)[nH]cn1 |
| InChI | InChI=1S/C7H11N3O/c1-3-10(2)6-4-7(11)9-5-8-6/h4-5H,3H2,1-2H3,(H,8,9,11) |
| InChIKey | RJMHPHQBWZWDPY-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.19 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |