C8H15N5O — CID 137008121
4-[bis(2-aminoethyl)amino]-1H-pyrimidin-6-one (PubChem CID 137008121) has the molecular formula C8H15N5O and a molecular weight of 197.24 g/mol. Its IUPAC name is 4-[bis(2-aminoethyl)amino]-1H-pyrimidin-6-one.
| Compound Name | 4-[bis(2-aminoethyl)amino]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 137008121 |
| Molecular Formula | C8H15N5O |
| Molecular Weight | 197.24 g/mol |
| Exact Mass | 197.13 |
| IUPAC Name | 4-[bis(2-aminoethyl)amino]-1H-pyrimidin-6-one |
| SMILES | NCCN(CCN)c1cc(=O)[nH]cn1 |
| InChI | InChI=1S/C8H15N5O/c9-1-3-13(4-2-10)7-5-8(14)12-6-11-7/h5-6H,1-4,9-10H2,(H,11,12,14) |
| InChIKey | NHGIIHXZSNAOLM-UHFFFAOYSA-N |
| XLogP | -1.51 |
| TPSA | 101.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.24 |
| LogP ≤ 5 | -1.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |