C25H35N5O2 — CID 136504725
4-(cyclohexylamino)-5-ethanimidoyl-2-[1-[(2-methoxyphenyl)methyl]piperidin-3-yl]-1H-pyrimidin-6-one (PubChem CID 136504725) has the molecular formula C25H35N5O2 and a molecular weight of 437.59 g/mol. Its IUPAC name is 4-(cyclohexylamino)-5-ethanimidoyl-2-[1-[(2-methoxyphenyl)methyl]piperidin-3-yl]-1H-pyrimidin-6-one.
| Compound Name | 4-(cyclohexylamino)-5-ethanimidoyl-2-[1-[(2-methoxyphenyl)methyl]piperidin-3-yl]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136504725 |
| Molecular Formula | C25H35N5O2 |
| Molecular Weight | 437.59 g/mol |
| Exact Mass | 437.28 |
| IUPAC Name | 4-(cyclohexylamino)-5-ethanimidoyl-2-[1-[(2-methoxyphenyl)methyl]piperidin-3-yl]-1H-pyrimidin-6-one |
| SMILES | [H]/N=C(\C)c1c(NC2CCCCC2)nc(C2CCCN(Cc3ccccc3OC)C2)[nH]c1=O |
| InChI | InChI=1S/C25H35N5O2/c1-17(26)22-24(27-20-11-4-3-5-12-20)28-23(29-25(22)31)19-10-8-14-30(16-19)15-18-9-6-7-13-21(18)32-2/h6-7,9,13,19-20,26H,3-5,8,10-12,14-16H2,1-2H3,(H2,27,28,29,31)/b26-17+ |
| InChIKey | SWSVXYQTMGJVLL-YZSQISJMSA-N |
| XLogP | 4.29 |
| TPSA | 94.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.59 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|