C20H31N5O3 — CID 143667639
tert-butyl 3-[4-(cyclohexylamino)-5-ethanimidoyl-6-oxo-1H-pyrimidin-2-yl]azetidine-1-carboxylate (PubChem CID 143667639) has the molecular formula C20H31N5O3 and a molecular weight of 389.50 g/mol. Its IUPAC name is tert-butyl 3-[4-(cyclohexylamino)-5-ethanimidoyl-6-oxo-1H-pyrimidin-2-yl]azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-[4-(cyclohexylamino)-5-ethanimidoyl-6-oxo-1H-pyrimidin-2-yl]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 143667639 |
| Molecular Formula | C20H31N5O3 |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.24 |
| IUPAC Name | tert-butyl 3-[4-(cyclohexylamino)-5-ethanimidoyl-6-oxo-1H-pyrimidin-2-yl]azetidine-1-carboxylate |
| SMILES | [H]/N=C(\C)c1c(NC2CCCCC2)nc(C2CN(C(=O)OC(C)(C)C)C2)[nH]c1=O |
| InChI | InChI=1S/C20H31N5O3/c1-12(21)15-17(22-14-8-6-5-7-9-14)23-16(24-18(15)26)13-10-25(11-13)19(27)28-20(2,3)4/h13-14,21H,5-11H2,1-4H3,(H2,22,23,24,26)/b21-12+ |
| InChIKey | GXAYDMNTMPFONP-CIAFOILYSA-N |
| XLogP | 3.24 |
| TPSA | 111.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|