C21H27N5O2 — CID 136504780
4-(cyclohexylamino)-5-methanimidoyl-2-[1-(2-methoxyphenyl)azetidin-3-yl]-1H-pyrimidin-6-one (PubChem CID 136504780) has the molecular formula C21H27N5O2 and a molecular weight of 381.48 g/mol. Its IUPAC name is 4-(cyclohexylamino)-5-methanimidoyl-2-[1-(2-methoxyphenyl)azetidin-3-yl]-1H-pyrimidin-6-one.
| Compound Name | 4-(cyclohexylamino)-5-methanimidoyl-2-[1-(2-methoxyphenyl)azetidin-3-yl]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 136504780 |
| Molecular Formula | C21H27N5O2 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.22 |
| IUPAC Name | 4-(cyclohexylamino)-5-methanimidoyl-2-[1-(2-methoxyphenyl)azetidin-3-yl]-1H-pyrimidin-6-one |
| SMILES | [H]/N=C/c1c(NC2CCCCC2)nc(C2CN(c3ccccc3OC)C2)[nH]c1=O |
| InChI | InChI=1S/C21H27N5O2/c1-28-18-10-6-5-9-17(18)26-12-14(13-26)19-24-20(16(11-22)21(27)25-19)23-15-7-3-2-4-8-15/h5-6,9-11,14-15,22H,2-4,7-8,12-13H2,1H3,(H2,23,24,25,27)/b22-11+ |
| InChIKey | WLHPTIJJICOSRX-SSDVNMTOSA-N |
| XLogP | 3.12 |
| TPSA | 94.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|