C22H28N6O2 — CID 136504786
N-[4-[3-[4-(cyclohexylamino)-5-methanimidoyl-6-oxo-1H-pyrimidin-2-yl]azetidin-1-yl]phenyl]acetamide (PubChem CID 136504786) has the molecular formula C22H28N6O2 and a molecular weight of 408.51 g/mol. Its IUPAC name is N-[4-[3-[4-(cyclohexylamino)-5-methanimidoyl-6-oxo-1H-pyrimidin-2-yl]azetidin-1-yl]phenyl]acetamide.
| Compound Name | N-[4-[3-[4-(cyclohexylamino)-5-methanimidoyl-6-oxo-1H-pyrimidin-2-yl]azetidin-1-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 136504786 |
| Molecular Formula | C22H28N6O2 |
| Molecular Weight | 408.51 g/mol |
| Exact Mass | 408.23 |
| IUPAC Name | N-[4-[3-[4-(cyclohexylamino)-5-methanimidoyl-6-oxo-1H-pyrimidin-2-yl]azetidin-1-yl]phenyl]acetamide |
| SMILES | [H]/N=C/c1c(NC2CCCCC2)nc(C2CN(c3ccc(NC(C)=O)cc3)C2)[nH]c1=O |
| InChI | InChI=1S/C22H28N6O2/c1-14(29)24-17-7-9-18(10-8-17)28-12-15(13-28)20-26-21(19(11-23)22(30)27-20)25-16-5-3-2-4-6-16/h7-11,15-16,23H,2-6,12-13H2,1H3,(H,24,29)(H2,25,26,27,30)/b23-11+ |
| InChIKey | MOUPQNXPOFUYPA-FOKLQQMPSA-N |
| XLogP | 3.07 |
| TPSA | 113.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.51 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|