C13H20N4O4S — CID 136650396
1-[5-methanimidoyl-4-(oxan-4-ylamino)-6-oxo-1H-pyrimidin-2-yl]ethyl methanesulfinate (PubChem CID 136650396) has the molecular formula C13H20N4O4S and a molecular weight of 328.39 g/mol. Its IUPAC name is 1-[5-methanimidoyl-4-(oxan-4-ylamino)-6-oxo-1H-pyrimidin-2-yl]ethyl methanesulfinate.
| Compound Name | 1-[5-methanimidoyl-4-(oxan-4-ylamino)-6-oxo-1H-pyrimidin-2-yl]ethyl methanesulfinate |
|---|---|
| PubChem CID | 136650396 |
| Molecular Formula | C13H20N4O4S |
| Molecular Weight | 328.39 g/mol |
| Exact Mass | 328.12 |
| IUPAC Name | 1-[5-methanimidoyl-4-(oxan-4-ylamino)-6-oxo-1H-pyrimidin-2-yl]ethyl methanesulfinate |
| SMILES | [H]/N=C/c1c(NC2CCOCC2)nc(C(C)OS(C)=O)[nH]c1=O |
| InChI | InChI=1S/C13H20N4O4S/c1-8(21-22(2)19)11-16-12(10(7-14)13(18)17-11)15-9-3-5-20-6-4-9/h7-9,14H,3-6H2,1-2H3,(H2,15,16,17,18)/b14-7+ |
| InChIKey | KVAIERBNECDEFT-VGOFMYFVSA-N |
| XLogP | 0.73 |
| TPSA | 117.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.39 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|