C18H32N4O2 — CID 143871263
ethane;2-(2-ethylbutyl)-5-methanimidoyl-4-(oxan-3-ylamino)-1H-pyrimidin-6-one (PubChem CID 143871263) has the molecular formula C18H32N4O2 and a molecular weight of 336.48 g/mol. Its IUPAC name is ethane;2-(2-ethylbutyl)-5-methanimidoyl-4-(oxan-3-ylamino)-1H-pyrimidin-6-one.
| Compound Name | ethane;2-(2-ethylbutyl)-5-methanimidoyl-4-(oxan-3-ylamino)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 143871263 |
| Molecular Formula | C18H32N4O2 |
| Molecular Weight | 336.48 g/mol |
| Exact Mass | 336.25 |
| IUPAC Name | ethane;2-(2-ethylbutyl)-5-methanimidoyl-4-(oxan-3-ylamino)-1H-pyrimidin-6-one |
| SMILES | CC.[H]/N=C/c1c(NC2CCCOC2)nc(CC(CC)CC)[nH]c1=O |
| InChI | InChI=1S/C16H26N4O2.C2H6/c1-3-11(4-2)8-14-19-15(13(9-17)16(21)20-14)18-12-6-5-7-22-10-12;1-2/h9,11-12,17H,3-8,10H2,1-2H3,(H2,18,19,20,21);1-2H3/b17-9+; |
| InChIKey | XFBCDFQKEIJBKU-WWIHJBQESA-N |
| XLogP | 3.36 |
| TPSA | 90.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.48 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|