C10H15N3O2 — CID 63363573
1-methyl-3-(oxan-3-ylamino)pyrazin-2-one (PubChem CID 63363573) has the molecular formula C10H15N3O2 and a molecular weight of 209.25 g/mol. Its IUPAC name is 1-methyl-3-(oxan-3-ylamino)pyrazin-2-one.
| Compound Name | 1-methyl-3-(oxan-3-ylamino)pyrazin-2-one |
|---|---|
| PubChem CID | 63363573 |
| Molecular Formula | C10H15N3O2 |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.12 |
| IUPAC Name | 1-methyl-3-(oxan-3-ylamino)pyrazin-2-one |
| SMILES | Cn1ccnc(NC2CCCOC2)c1=O |
| InChI | InChI=1S/C10H15N3O2/c1-13-5-4-11-9(10(13)14)12-8-3-2-6-15-7-8/h4-5,8H,2-3,6-7H2,1H3,(H,11,12) |
| InChIKey | VDXRFRXGSBGPBW-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |