C11H18N4O — CID 94896988
3-[[(1R,2R)-2-aminocyclohexyl]amino]-1-methylpyrazin-2-one (PubChem CID 94896988) has the molecular formula C11H18N4O and a molecular weight of 222.29 g/mol. Its IUPAC name is 3-[[(1R,2R)-2-aminocyclohexyl]amino]-1-methylpyrazin-2-one.
| Compound Name | 3-[[(1R,2R)-2-aminocyclohexyl]amino]-1-methylpyrazin-2-one |
|---|---|
| PubChem CID | 94896988 |
| Molecular Formula | C11H18N4O |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.15 |
| IUPAC Name | 3-[[(1R,2R)-2-aminocyclohexyl]amino]-1-methylpyrazin-2-one |
| SMILES | Cn1ccnc(N[C@@H]2CCCC[C@H]2N)c1=O |
| InChI | InChI=1S/C11H18N4O/c1-15-7-6-13-10(11(15)16)14-9-5-3-2-4-8(9)12/h6-9H,2-5,12H2,1H3,(H,13,14)/t8-,9-/m1/s1 |
| InChIKey | KPZLEYMFOCOHNJ-RKDXNWHRSA-N |
| XLogP | 0.46 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |