C9H16N4 — CID 63252580
1-N-(1-methylimidazol-2-yl)cyclopentane-1,2-diamine (PubChem CID 63252580) has the molecular formula C9H16N4 and a molecular weight of 180.25 g/mol. Its IUPAC name is 1-N-(1-methylimidazol-2-yl)cyclopentane-1,2-diamine.
| Compound Name | 1-N-(1-methylimidazol-2-yl)cyclopentane-1,2-diamine |
|---|---|
| PubChem CID | 63252580 |
| Molecular Formula | C9H16N4 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.14 |
| IUPAC Name | 1-N-(1-methylimidazol-2-yl)cyclopentane-1,2-diamine |
| SMILES | Cn1ccnc1NC1CCCC1N |
| InChI | InChI=1S/C9H16N4/c1-13-6-5-11-9(13)12-8-4-2-3-7(8)10/h5-8H,2-4,10H2,1H3,(H,11,12) |
| InChIKey | XBZDOFSSSUOELB-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |