C26H32FN5O2 — CID 143871276
2-fluoro-2-methylpropane;5-methanimidoyl-4-(oxan-4-ylamino)-2-[(2-pyridin-4-ylphenyl)methyl]-1H-pyrimidin-6-one (PubChem CID 143871276) has the molecular formula C26H32FN5O2 and a molecular weight of 465.57 g/mol. Its IUPAC name is 2-fluoro-2-methylpropane;5-methanimidoyl-4-(oxan-4-ylamino)-2-[(2-pyridin-4-ylphenyl)methyl]-1H-pyrimidin-6-one.
| Compound Name | 2-fluoro-2-methylpropane;5-methanimidoyl-4-(oxan-4-ylamino)-2-[(2-pyridin-4-ylphenyl)methyl]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 143871276 |
| Molecular Formula | C26H32FN5O2 |
| Molecular Weight | 465.57 g/mol |
| Exact Mass | 465.25 |
| IUPAC Name | 2-fluoro-2-methylpropane;5-methanimidoyl-4-(oxan-4-ylamino)-2-[(2-pyridin-4-ylphenyl)methyl]-1H-pyrimidin-6-one |
| SMILES | CC(C)(C)F.[H]/N=C/c1c(NC2CCOCC2)nc(Cc2ccccc2-c2ccncc2)[nH]c1=O |
| InChI | InChI=1S/C22H23N5O2.C4H9F/c23-14-19-21(25-17-7-11-29-12-8-17)26-20(27-22(19)28)13-16-3-1-2-4-18(16)15-5-9-24-10-6-15;1-4(2,3)5/h1-6,9-10,14,17,23H,7-8,11-13H2,(H2,25,26,27,28);1-3H3/b23-14+; |
| InChIKey | JMWIPIMDFHEFDD-MHVDTSALSA-N |
| XLogP | 4.77 |
| TPSA | 103.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.57 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|