C21H26N4O4 — CID 143871258
5-methanimidoyl-4-(oxan-4-ylamino)-2-[[2-[(3S)-oxolan-3-yl]oxyphenyl]methyl]-1H-pyrimidin-6-one (PubChem CID 143871258) has the molecular formula C21H26N4O4 and a molecular weight of 398.46 g/mol. Its IUPAC name is 5-methanimidoyl-4-(oxan-4-ylamino)-2-[[2-[(3S)-oxolan-3-yl]oxyphenyl]methyl]-1H-pyrimidin-6-one.
| Compound Name | 5-methanimidoyl-4-(oxan-4-ylamino)-2-[[2-[(3S)-oxolan-3-yl]oxyphenyl]methyl]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 143871258 |
| Molecular Formula | C21H26N4O4 |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.20 |
| IUPAC Name | 5-methanimidoyl-4-(oxan-4-ylamino)-2-[[2-[(3S)-oxolan-3-yl]oxyphenyl]methyl]-1H-pyrimidin-6-one |
| SMILES | [H]/N=C/c1c(NC2CCOCC2)nc(Cc2ccccc2O[C@H]2CCOC2)[nH]c1=O |
| InChI | InChI=1S/C21H26N4O4/c22-12-17-20(23-15-5-8-27-9-6-15)24-19(25-21(17)26)11-14-3-1-2-4-18(14)29-16-7-10-28-13-16/h1-4,12,15-16,22H,5-11,13H2,(H2,23,24,25,26)/b22-12+/t16-/m0/s1 |
| InChIKey | LBMDKXBQBUMOGV-BFTVFPACSA-N |
| XLogP | 2.12 |
| TPSA | 109.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|