C21H19F3N4O2 — CID 143811106
4-(2,3-dimethylanilino)-5-methanimidoyl-2-[[2-(trifluoromethoxy)phenyl]methyl]-1H-pyrimidin-6-one (PubChem CID 143811106) has the molecular formula C21H19F3N4O2 and a molecular weight of 416.40 g/mol. Its IUPAC name is 4-(2,3-dimethylanilino)-5-methanimidoyl-2-[[2-(trifluoromethoxy)phenyl]methyl]-1H-pyrimidin-6-one.
| Compound Name | 4-(2,3-dimethylanilino)-5-methanimidoyl-2-[[2-(trifluoromethoxy)phenyl]methyl]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 143811106 |
| Molecular Formula | C21H19F3N4O2 |
| Molecular Weight | 416.40 g/mol |
| Exact Mass | 416.15 |
| IUPAC Name | 4-(2,3-dimethylanilino)-5-methanimidoyl-2-[[2-(trifluoromethoxy)phenyl]methyl]-1H-pyrimidin-6-one |
| SMILES | [H]/N=C/c1c(Nc2cccc(C)c2C)nc(Cc2ccccc2OC(F)(F)F)[nH]c1=O |
| InChI | InChI=1S/C21H19F3N4O2/c1-12-6-5-8-16(13(12)2)26-19-15(11-25)20(29)28-18(27-19)10-14-7-3-4-9-17(14)30-21(22,23)24/h3-9,11,25H,10H2,1-2H3,(H2,26,27,28,29)/b25-11+ |
| InChIKey | YBGXKPHSKALCIG-OPEKNORGSA-N |
| XLogP | 4.62 |
| TPSA | 90.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.40 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|