C19H13F6N3O2 — CID 162221534
N-[2-(trifluoromethoxy)phenyl]-3-[[2-(trifluoromethoxy)phenyl]methyl]pyrazin-2-amine (PubChem CID 162221534) has the molecular formula C19H13F6N3O2 and a molecular weight of 429.32 g/mol. Its IUPAC name is N-[2-(trifluoromethoxy)phenyl]-3-[[2-(trifluoromethoxy)phenyl]methyl]pyrazin-2-amine.
| Compound Name | N-[2-(trifluoromethoxy)phenyl]-3-[[2-(trifluoromethoxy)phenyl]methyl]pyrazin-2-amine |
|---|---|
| PubChem CID | 162221534 |
| Molecular Formula | C19H13F6N3O2 |
| Molecular Weight | 429.32 g/mol |
| Exact Mass | 429.09 |
| IUPAC Name | N-[2-(trifluoromethoxy)phenyl]-3-[[2-(trifluoromethoxy)phenyl]methyl]pyrazin-2-amine |
| SMILES | FC(F)(F)Oc1ccccc1Cc1nccnc1Nc1ccccc1OC(F)(F)F |
| InChI | InChI=1S/C19H13F6N3O2/c20-18(21,22)29-15-7-3-1-5-12(15)11-14-17(27-10-9-26-14)28-13-6-2-4-8-16(13)30-19(23,24)25/h1-10H,11H2,(H,27,28) |
| InChIKey | ZUEOXTXNPWPCHD-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 56.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.32 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |