C25H37N5O3S — CID 143667665
2-[1-(3,4-dimethoxyphenyl)sulfanylpiperidin-3-yl]-4-(heptan-3-ylamino)-5-methanimidoyl-1H-pyrimidin-6-one (PubChem CID 143667665) has the molecular formula C25H37N5O3S and a molecular weight of 487.67 g/mol. Its IUPAC name is 2-[1-(3,4-dimethoxyphenyl)sulfanylpiperidin-3-yl]-4-(heptan-3-ylamino)-5-methanimidoyl-1H-pyrimidin-6-one.
| Compound Name | 2-[1-(3,4-dimethoxyphenyl)sulfanylpiperidin-3-yl]-4-(heptan-3-ylamino)-5-methanimidoyl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 143667665 |
| Molecular Formula | C25H37N5O3S |
| Molecular Weight | 487.67 g/mol |
| Exact Mass | 487.26 |
| IUPAC Name | 2-[1-(3,4-dimethoxyphenyl)sulfanylpiperidin-3-yl]-4-(heptan-3-ylamino)-5-methanimidoyl-1H-pyrimidin-6-one |
| SMILES | [H]/N=C/c1c(NC(CC)CCCC)nc(C2CCCN(Sc3ccc(OC)c(OC)c3)C2)[nH]c1=O |
| InChI | InChI=1S/C25H37N5O3S/c1-5-7-10-18(6-2)27-24-20(15-26)25(31)29-23(28-24)17-9-8-13-30(16-17)34-19-11-12-21(32-3)22(14-19)33-4/h11-12,14-15,17-18,26H,5-10,13,16H2,1-4H3,(H2,27,28,29,31)/b26-15+ |
| InChIKey | FZEXDWHWNBNIQT-CVKSISIWSA-N |
| XLogP | 5.05 |
| TPSA | 103.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.67 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|