C23H34N2O4S2 — CID 143573166
3,4-dimethoxybenzenethiol;1-(3,4-dimethoxyphenyl)sulfanyl-N-propylpyrrolidin-3-amine (PubChem CID 143573166) has the molecular formula C23H34N2O4S2 and a molecular weight of 466.67 g/mol. Its IUPAC name is 3,4-dimethoxybenzenethiol;1-(3,4-dimethoxyphenyl)sulfanyl-N-propylpyrrolidin-3-amine.
| Compound Name | 3,4-dimethoxybenzenethiol;1-(3,4-dimethoxyphenyl)sulfanyl-N-propylpyrrolidin-3-amine |
|---|---|
| PubChem CID | 143573166 |
| Molecular Formula | C23H34N2O4S2 |
| Molecular Weight | 466.67 g/mol |
| Exact Mass | 466.20 |
| IUPAC Name | 3,4-dimethoxybenzenethiol;1-(3,4-dimethoxyphenyl)sulfanyl-N-propylpyrrolidin-3-amine |
| SMILES | CCCNC1CCN(Sc2ccc(OC)c(OC)c2)C1.COc1ccc(S)cc1OC |
| InChI | InChI=1S/C15H24N2O2S.C8H10O2S/c1-4-8-16-12-7-9-17(11-12)20-13-5-6-14(18-2)15(10-13)19-3;1-9-7-4-3-6(11)5-8(7)10-2/h5-6,10,12,16H,4,7-9,11H2,1-3H3;3-5,11H,1-2H3 |
| InChIKey | UAOJMMNBRWHVDI-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 52.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.67 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|