C26H36N2O6S2 — CID 143573179
2-cyclohexyl-4-(3,4-dimethoxyphenyl)sulfanyl-1-(3,4-dimethoxyphenyl)sulfonylpiperazine (PubChem CID 143573179) has the molecular formula C26H36N2O6S2 and a molecular weight of 536.72 g/mol. Its IUPAC name is 2-cyclohexyl-4-(3,4-dimethoxyphenyl)sulfanyl-1-(3,4-dimethoxyphenyl)sulfonylpiperazine.
| Compound Name | 2-cyclohexyl-4-(3,4-dimethoxyphenyl)sulfanyl-1-(3,4-dimethoxyphenyl)sulfonylpiperazine |
|---|---|
| PubChem CID | 143573179 |
| Molecular Formula | C26H36N2O6S2 |
| Molecular Weight | 536.72 g/mol |
| Exact Mass | 536.20 |
| IUPAC Name | 2-cyclohexyl-4-(3,4-dimethoxyphenyl)sulfanyl-1-(3,4-dimethoxyphenyl)sulfonylpiperazine |
| SMILES | COc1ccc(SN2CCN(S(=O)(=O)c3ccc(OC)c(OC)c3)C(C3CCCCC3)C2)cc1OC |
| InChI | InChI=1S/C26H36N2O6S2/c1-31-23-12-10-20(16-25(23)33-3)35-27-14-15-28(22(18-27)19-8-6-5-7-9-19)36(29,30)21-11-13-24(32-2)26(17-21)34-4/h10-13,16-17,19,22H,5-9,14-15,18H2,1-4H3 |
| InChIKey | XCQHFURWYAACNH-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 77.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.72 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|