C16H19N5O2 — CID 163363010
tert-butyl 3-(3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,3,6,8,11-pentaen-4-yl)azetidine-1-carboxylate (PubChem CID 163363010) has the molecular formula C16H19N5O2 and a molecular weight of 313.36 g/mol. Its IUPAC name is tert-butyl 3-(3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,3,6,8,11-pentaen-4-yl)azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-(3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,3,6,8,11-pentaen-4-yl)azetidine-1-carboxylate |
|---|---|
| PubChem CID | 163363010 |
| Molecular Formula | C16H19N5O2 |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | tert-butyl 3-(3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,3,6,8,11-pentaen-4-yl)azetidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(c2nc3c(cnc4[nH]ccc43)[nH]2)C1 |
| InChI | InChI=1S/C16H19N5O2/c1-16(2,3)23-15(22)21-7-9(8-21)13-19-11-6-18-14-10(4-5-17-14)12(11)20-13/h4-6,9H,7-8H2,1-3H3,(H,17,18)(H,19,20) |
| InChIKey | GOXPIWHYGQPBNZ-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 86.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |