C15H17N5O — CID 135142976
1-[4-(3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,3,6,8,11-pentaen-4-yl)piperidin-1-yl]ethanone (PubChem CID 135142976) has the molecular formula C15H17N5O and a molecular weight of 283.33 g/mol. Its IUPAC name is 1-[4-(3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,3,6,8,11-pentaen-4-yl)piperidin-1-yl]ethanone.
| Compound Name | 1-[4-(3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,3,6,8,11-pentaen-4-yl)piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 135142976 |
| Molecular Formula | C15H17N5O |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | 1-[4-(3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,3,6,8,11-pentaen-4-yl)piperidin-1-yl]ethanone |
| SMILES | CC(=O)N1CCC(c2nc3c(cnc4[nH]ccc43)[nH]2)CC1 |
| InChI | InChI=1S/C15H17N5O/c1-9(21)20-6-3-10(4-7-20)14-18-12-8-17-15-11(2-5-16-15)13(12)19-14/h2,5,8,10H,3-4,6-7H2,1H3,(H,16,17)(H,18,19) |
| InChIKey | VMCVRCOZTYGCRM-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 77.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |