C16H21N5O2S — CID 67325591
N-[cyclohexyl(3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,3,6,8,11-pentaen-4-yl)methyl]methanesulfonamide (PubChem CID 67325591) has the molecular formula C16H21N5O2S and a molecular weight of 347.44 g/mol. Its IUPAC name is N-[cyclohexyl(3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,3,6,8,11-pentaen-4-yl)methyl]methanesulfonamide.
| Compound Name | N-[cyclohexyl(3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,3,6,8,11-pentaen-4-yl)methyl]methanesulfonamide |
|---|---|
| PubChem CID | 67325591 |
| Molecular Formula | C16H21N5O2S |
| Molecular Weight | 347.44 g/mol |
| Exact Mass | 347.14 |
| IUPAC Name | N-[cyclohexyl(3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,3,6,8,11-pentaen-4-yl)methyl]methanesulfonamide |
| SMILES | CS(=O)(=O)NC(c1nc2c(cnc3[nH]ccc32)[nH]1)C1CCCCC1 |
| InChI | InChI=1S/C16H21N5O2S/c1-24(22,23)21-13(10-5-3-2-4-6-10)16-19-12-9-18-15-11(7-8-17-15)14(12)20-16/h7-10,13,21H,2-6H2,1H3,(H,17,18)(H,19,20) |
| InChIKey | APAHIRRUGKWGEN-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 103.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.44 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |