C18H21ClN6 — CID 142379873
4-(4-chloro-1H-pyrazol-5-yl)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,3,6,8,11-pentaene;methylcyclohexane (PubChem CID 142379873) has the molecular formula C18H21ClN6 and a molecular weight of 356.86 g/mol. Its IUPAC name is 4-(4-chloro-1H-pyrazol-5-yl)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,3,6,8,11-pentaene;methylcyclohexane.
| Compound Name | 4-(4-chloro-1H-pyrazol-5-yl)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,3,6,8,11-pentaene;methylcyclohexane |
|---|---|
| PubChem CID | 142379873 |
| Molecular Formula | C18H21ClN6 |
| Molecular Weight | 356.86 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | 4-(4-chloro-1H-pyrazol-5-yl)-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,3,6,8,11-pentaene;methylcyclohexane |
| SMILES | CC1CCCCC1.Clc1cn[nH]c1-c1nc2c(cnc3[nH]ccc32)[nH]1 |
| InChI | InChI=1S/C11H7ClN6.C7H14/c12-6-3-15-18-9(6)11-16-7-4-14-10-5(1-2-13-10)8(7)17-11;1-7-5-3-2-4-6-7/h1-4H,(H,13,14)(H,15,18)(H,16,17);7H,2-6H2,1H3 |
| InChIKey | RNSCOMMSYLJNOR-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 86.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.86 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |