C24H28F3N7O — CID 136507299
(7S)-N-[2-methyl-1-[(5-methylpyrazin-2-yl)methylamino]propan-2-yl]-5-phenyl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carboxamide (PubChem CID 136507299) has the molecular formula C24H28F3N7O and a molecular weight of 487.53 g/mol. Its IUPAC name is (7S)-N-[2-methyl-1-[(5-methylpyrazin-2-yl)methylamino]propan-2-yl]-5-phenyl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carboxamide.
| Compound Name | (7S)-N-[2-methyl-1-[(5-methylpyrazin-2-yl)methylamino]propan-2-yl]-5-phenyl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carboxamide |
|---|---|
| PubChem CID | 136507299 |
| Molecular Formula | C24H28F3N7O |
| Molecular Weight | 487.53 g/mol |
| Exact Mass | 487.23 |
| IUPAC Name | (7S)-N-[2-methyl-1-[(5-methylpyrazin-2-yl)methylamino]propan-2-yl]-5-phenyl-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-3-carboxamide |
| SMILES | Cc1cnc(CNCC(C)(C)NC(=O)c2cnn3c2NC(c2ccccc2)C[C@H]3C(F)(F)F)cn1 |
| InChI | InChI=1S/C24H28F3N7O/c1-15-10-30-17(12-29-15)11-28-14-23(2,3)33-22(35)18-13-31-34-20(24(25,26)27)9-19(32-21(18)34)16-7-5-4-6-8-16/h4-8,10,12-13,19-20,28,32H,9,11,14H2,1-3H3,(H,33,35)/t19?,20-/m0/s1 |
| InChIKey | NBDPTPGYDWZAPX-ANYOKISRSA-N |
| XLogP | 3.94 |
| TPSA | 96.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.53 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |