C18H15N3O3S — CID 136508999
N-[(E)-(3,4-dihydroxyphenyl)methylideneamino]-2-(2-methylphenyl)-1,3-thiazole-5-carboxamide (PubChem CID 136508999) has the molecular formula C18H15N3O3S and a molecular weight of 353.40 g/mol. Its IUPAC name is N-[(E)-(3,4-dihydroxyphenyl)methylideneamino]-2-(2-methylphenyl)-1,3-thiazole-5-carboxamide.
| Compound Name | N-[(E)-(3,4-dihydroxyphenyl)methylideneamino]-2-(2-methylphenyl)-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 136508999 |
| Molecular Formula | C18H15N3O3S |
| Molecular Weight | 353.40 g/mol |
| Exact Mass | 353.08 |
| IUPAC Name | N-[(E)-(3,4-dihydroxyphenyl)methylideneamino]-2-(2-methylphenyl)-1,3-thiazole-5-carboxamide |
| SMILES | Cc1ccccc1-c1ncc(C(=O)N/N=C/c2ccc(O)c(O)c2)s1 |
| InChI | InChI=1S/C18H15N3O3S/c1-11-4-2-3-5-13(11)18-19-10-16(25-18)17(24)21-20-9-12-6-7-14(22)15(23)8-12/h2-10,22-23H,1H3,(H,21,24)/b20-9+ |
| InChIKey | QXDZRCFEMYDTHE-AWQFTUOYSA-N |
| XLogP | 3.29 |
| TPSA | 94.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.40 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|