C14H10N2O3S — CID 136511062
2-hydroxy-5-(7-methyl-2,1,3-benzothiadiazol-4-yl)benzoic acid (PubChem CID 136511062) has the molecular formula C14H10N2O3S and a molecular weight of 286.31 g/mol. Its IUPAC name is 2-hydroxy-5-(7-methyl-2,1,3-benzothiadiazol-4-yl)benzoic acid.
| Compound Name | 2-hydroxy-5-(7-methyl-2,1,3-benzothiadiazol-4-yl)benzoic acid |
|---|---|
| PubChem CID | 136511062 |
| Molecular Formula | C14H10N2O3S |
| Molecular Weight | 286.31 g/mol |
| Exact Mass | 286.04 |
| IUPAC Name | 2-hydroxy-5-(7-methyl-2,1,3-benzothiadiazol-4-yl)benzoic acid |
| SMILES | Cc1ccc(-c2ccc(O)c(C(=O)O)c2)c2nsnc12 |
| InChI | InChI=1S/C14H10N2O3S/c1-7-2-4-9(13-12(7)15-20-16-13)8-3-5-11(17)10(6-8)14(18)19/h2-6,17H,1H3,(H,18,19) |
| InChIKey | BUXMAOLBOIRSNJ-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 83.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.31 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |