C16H26N2O4S2 — CID 136511986
1-[4-(2-propan-2-yloxyethylsulfonyl)piperazin-1-yl]-2-thiophen-2-ylpropan-1-one (PubChem CID 136511986) has the molecular formula C16H26N2O4S2 and a molecular weight of 374.53 g/mol. Its IUPAC name is 1-[4-(2-propan-2-yloxyethylsulfonyl)piperazin-1-yl]-2-thiophen-2-ylpropan-1-one.
| Compound Name | 1-[4-(2-propan-2-yloxyethylsulfonyl)piperazin-1-yl]-2-thiophen-2-ylpropan-1-one |
|---|---|
| PubChem CID | 136511986 |
| Molecular Formula | C16H26N2O4S2 |
| Molecular Weight | 374.53 g/mol |
| Exact Mass | 374.13 |
| IUPAC Name | 1-[4-(2-propan-2-yloxyethylsulfonyl)piperazin-1-yl]-2-thiophen-2-ylpropan-1-one |
| SMILES | CC(C)OCCS(=O)(=O)N1CCN(C(=O)C(C)c2cccs2)CC1 |
| InChI | InChI=1S/C16H26N2O4S2/c1-13(2)22-10-12-24(20,21)18-8-6-17(7-9-18)16(19)14(3)15-5-4-11-23-15/h4-5,11,13-14H,6-10,12H2,1-3H3 |
| InChIKey | SITTZDFEJUVVQE-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.53 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |