C13H16N2O3S2 — CID 136513376
4-cyano-N-(cyclohexylmethylsulfonyl)thiophene-2-carboxamide (PubChem CID 136513376) has the molecular formula C13H16N2O3S2 and a molecular weight of 312.42 g/mol. Its IUPAC name is 4-cyano-N-(cyclohexylmethylsulfonyl)thiophene-2-carboxamide.
| Compound Name | 4-cyano-N-(cyclohexylmethylsulfonyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 136513376 |
| Molecular Formula | C13H16N2O3S2 |
| Molecular Weight | 312.42 g/mol |
| Exact Mass | 312.06 |
| IUPAC Name | 4-cyano-N-(cyclohexylmethylsulfonyl)thiophene-2-carboxamide |
| SMILES | N#Cc1csc(C(=O)NS(=O)(=O)CC2CCCCC2)c1 |
| InChI | InChI=1S/C13H16N2O3S2/c14-7-11-6-12(19-8-11)13(16)15-20(17,18)9-10-4-2-1-3-5-10/h6,8,10H,1-5,9H2,(H,15,16) |
| InChIKey | UPFGRRMQRUQBLJ-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 87.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.42 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |