C17H25N3O2 — CID 136513983
1,3,3-trimethyl-4-[3-(2-methylanilino)propanoyl]piperazin-2-one (PubChem CID 136513983) has the molecular formula C17H25N3O2 and a molecular weight of 303.41 g/mol. Its IUPAC name is 1,3,3-trimethyl-4-[3-(2-methylanilino)propanoyl]piperazin-2-one.
| Compound Name | 1,3,3-trimethyl-4-[3-(2-methylanilino)propanoyl]piperazin-2-one |
|---|---|
| PubChem CID | 136513983 |
| Molecular Formula | C17H25N3O2 |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.19 |
| IUPAC Name | 1,3,3-trimethyl-4-[3-(2-methylanilino)propanoyl]piperazin-2-one |
| SMILES | Cc1ccccc1NCCC(=O)N1CCN(C)C(=O)C1(C)C |
| InChI | InChI=1S/C17H25N3O2/c1-13-7-5-6-8-14(13)18-10-9-15(21)20-12-11-19(4)16(22)17(20,2)3/h5-8,18H,9-12H2,1-4H3 |
| InChIKey | JMYDTMAYZHZZRE-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |