C14H22N2O — CID 109030597
N,N-diethyl-3-(2-methylanilino)propanamide (PubChem CID 109030597) has the molecular formula C14H22N2O and a molecular weight of 234.34 g/mol. Its IUPAC name is N,N-diethyl-3-(2-methylanilino)propanamide.
| Compound Name | N,N-diethyl-3-(2-methylanilino)propanamide |
|---|---|
| PubChem CID | 109030597 |
| Molecular Formula | C14H22N2O |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.17 |
| IUPAC Name | N,N-diethyl-3-(2-methylanilino)propanamide |
| SMILES | CCN(CC)C(=O)CCNc1ccccc1C |
| InChI | InChI=1S/C14H22N2O/c1-4-16(5-2)14(17)10-11-15-13-9-7-6-8-12(13)3/h6-9,15H,4-5,10-11H2,1-3H3 |
| InChIKey | ODYDDBQKDCCJFC-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |