C18H28N2O — CID 67968203
N-(cyclohexylmethyl)-N-methyl-3-(2-methylanilino)propanamide (PubChem CID 67968203) has the molecular formula C18H28N2O and a molecular weight of 288.44 g/mol. Its IUPAC name is N-(cyclohexylmethyl)-N-methyl-3-(2-methylanilino)propanamide.
| Compound Name | N-(cyclohexylmethyl)-N-methyl-3-(2-methylanilino)propanamide |
|---|---|
| PubChem CID | 67968203 |
| Molecular Formula | C18H28N2O |
| Molecular Weight | 288.44 g/mol |
| Exact Mass | 288.22 |
| IUPAC Name | N-(cyclohexylmethyl)-N-methyl-3-(2-methylanilino)propanamide |
| SMILES | Cc1ccccc1NCCC(=O)N(C)CC1CCCCC1 |
| InChI | InChI=1S/C18H28N2O/c1-15-8-6-7-11-17(15)19-13-12-18(21)20(2)14-16-9-4-3-5-10-16/h6-8,11,16,19H,3-5,9-10,12-14H2,1-2H3 |
| InChIKey | ZDWNTPQTKNARGZ-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.44 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |