C18H23FN4O2 — CID 136514717
N-[(3-fluoro-4-methoxyphenyl)methyl]-3-imidazol-1-yl-4-methylpiperidine-1-carboxamide (PubChem CID 136514717) has the molecular formula C18H23FN4O2 and a molecular weight of 346.41 g/mol. Its IUPAC name is N-[(3-fluoro-4-methoxyphenyl)methyl]-3-imidazol-1-yl-4-methylpiperidine-1-carboxamide.
| Compound Name | N-[(3-fluoro-4-methoxyphenyl)methyl]-3-imidazol-1-yl-4-methylpiperidine-1-carboxamide |
|---|---|
| PubChem CID | 136514717 |
| Molecular Formula | C18H23FN4O2 |
| Molecular Weight | 346.41 g/mol |
| Exact Mass | 346.18 |
| IUPAC Name | N-[(3-fluoro-4-methoxyphenyl)methyl]-3-imidazol-1-yl-4-methylpiperidine-1-carboxamide |
| SMILES | COc1ccc(CNC(=O)N2CCC(C)C(n3ccnc3)C2)cc1F |
| InChI | InChI=1S/C18H23FN4O2/c1-13-5-7-22(11-16(13)23-8-6-20-12-23)18(24)21-10-14-3-4-17(25-2)15(19)9-14/h3-4,6,8-9,12-13,16H,5,7,10-11H2,1-2H3,(H,21,24) |
| InChIKey | IEXQMLIWZWKXBA-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.41 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |