C15H15FN2O4S — CID 136514815
N-[4-fluoro-2-(methylsulfonylmethyl)phenyl]-2-methoxypyridine-3-carboxamide (PubChem CID 136514815) has the molecular formula C15H15FN2O4S and a molecular weight of 338.36 g/mol. Its IUPAC name is N-[4-fluoro-2-(methylsulfonylmethyl)phenyl]-2-methoxypyridine-3-carboxamide.
| Compound Name | N-[4-fluoro-2-(methylsulfonylmethyl)phenyl]-2-methoxypyridine-3-carboxamide |
|---|---|
| PubChem CID | 136514815 |
| Molecular Formula | C15H15FN2O4S |
| Molecular Weight | 338.36 g/mol |
| Exact Mass | 338.07 |
| IUPAC Name | N-[4-fluoro-2-(methylsulfonylmethyl)phenyl]-2-methoxypyridine-3-carboxamide |
| SMILES | COc1ncccc1C(=O)Nc1ccc(F)cc1CS(C)(=O)=O |
| InChI | InChI=1S/C15H15FN2O4S/c1-22-15-12(4-3-7-17-15)14(19)18-13-6-5-11(16)8-10(13)9-23(2,20)21/h3-8H,9H2,1-2H3,(H,18,19) |
| InChIKey | YBBGNAMPYXLMEB-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.36 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |