C17H24FN3O2 — CID 136515635
N-(4-fluoro-2-methoxyphenyl)-1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridine-6-carboxamide (PubChem CID 136515635) has the molecular formula C17H24FN3O2 and a molecular weight of 321.40 g/mol. Its IUPAC name is N-(4-fluoro-2-methoxyphenyl)-1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridine-6-carboxamide.
| Compound Name | N-(4-fluoro-2-methoxyphenyl)-1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridine-6-carboxamide |
|---|---|
| PubChem CID | 136515635 |
| Molecular Formula | C17H24FN3O2 |
| Molecular Weight | 321.40 g/mol |
| Exact Mass | 321.19 |
| IUPAC Name | N-(4-fluoro-2-methoxyphenyl)-1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridine-6-carboxamide |
| SMILES | COc1cc(F)ccc1NC(=O)N1CCC2C(CCCN2C)C1 |
| InChI | InChI=1S/C17H24FN3O2/c1-20-8-3-4-12-11-21(9-7-15(12)20)17(22)19-14-6-5-13(18)10-16(14)23-2/h5-6,10,12,15H,3-4,7-9,11H2,1-2H3,(H,19,22) |
| InChIKey | YFYJNVXWPALRDP-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.40 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |