C21H32N4O3 — CID 136515660
N-[4-(dimethylcarbamoyl)-2-ethoxyphenyl]-1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridine-6-carboxamide (PubChem CID 136515660) has the molecular formula C21H32N4O3 and a molecular weight of 388.51 g/mol. Its IUPAC name is N-[4-(dimethylcarbamoyl)-2-ethoxyphenyl]-1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridine-6-carboxamide.
| Compound Name | N-[4-(dimethylcarbamoyl)-2-ethoxyphenyl]-1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridine-6-carboxamide |
|---|---|
| PubChem CID | 136515660 |
| Molecular Formula | C21H32N4O3 |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.25 |
| IUPAC Name | N-[4-(dimethylcarbamoyl)-2-ethoxyphenyl]-1-methyl-2,3,4,4a,5,7,8,8a-octahydro-1,6-naphthyridine-6-carboxamide |
| SMILES | CCOc1cc(C(=O)N(C)C)ccc1NC(=O)N1CCC2C(CCCN2C)C1 |
| InChI | InChI=1S/C21H32N4O3/c1-5-28-19-13-15(20(26)23(2)3)8-9-17(19)22-21(27)25-12-10-18-16(14-25)7-6-11-24(18)4/h8-9,13,16,18H,5-7,10-12,14H2,1-4H3,(H,22,27) |
| InChIKey | UJCDIQWYDBVBOD-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |