C20H30N4O3 — CID 136516505
N-[5-(dimethylcarbamoyl)-2-methoxyphenyl]-3-ethyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine-2-carboxamide (PubChem CID 136516505) has the molecular formula C20H30N4O3 and a molecular weight of 374.49 g/mol. Its IUPAC name is N-[5-(dimethylcarbamoyl)-2-methoxyphenyl]-3-ethyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine-2-carboxamide.
| Compound Name | N-[5-(dimethylcarbamoyl)-2-methoxyphenyl]-3-ethyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 136516505 |
| Molecular Formula | C20H30N4O3 |
| Molecular Weight | 374.49 g/mol |
| Exact Mass | 374.23 |
| IUPAC Name | N-[5-(dimethylcarbamoyl)-2-methoxyphenyl]-3-ethyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine-2-carboxamide |
| SMILES | CCC1CN2CCCC2CN1C(=O)Nc1cc(C(=O)N(C)C)ccc1OC |
| InChI | InChI=1S/C20H30N4O3/c1-5-15-12-23-10-6-7-16(23)13-24(15)20(26)21-17-11-14(19(25)22(2)3)8-9-18(17)27-4/h8-9,11,15-16H,5-7,10,12-13H2,1-4H3,(H,21,26) |
| InChIKey | HPWFWAXWOZFNOF-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.49 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |